Sennoside C
- Product NameSennoside C
- CAS37271-16-2
- MFC42H40O19
- MW848.76
- EINECS
- MOL File37271-16-2.mol
Chemical Properties
| Boiling point | 1130.3±65.0 °C(Predicted) |
| Density | 1.710±0.06 g/cm3(Predicted) |
| Flash point | 344℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in dioxane; sparingly soluble in acetone and methanol; insoluble in chloroform, diethyl ether and water |
| form | Solid |
| pka | 3.61±0.40(Predicted) |
| color | Yellowish |
| Major Application | food and beverages |
| InChIKey | ZFWOUNNKSHIAFK-UHFFFAOYSA-N |
| SMILES | O(C1C(C(C(C(O1)CO)O)O)O)C1C=CC=C2C=1C(C1=C(C=C(C=C1C2C1C2=CC(=CC(=C2C(C2=C(C=CC=C12)OC1C(C(C(C(O1)CO)O)O)O)=O)O)CO)C(=O)O)O)=O |
Safety Information
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
