Fmoc-L-aspartic acid 4-benzyl ester
- Product NameFmoc-L-aspartic acid 4-benzyl ester
- CAS86060-84-6
- MFC26H23NO6
- MW445.46
- EINECS
- MOL File86060-84-6.mol
Chemical Properties
| Melting point | 120-130 °C |
| alpha | -20 º (c=1% in DMF) |
| Boiling point | 687.2±55.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 3.54±0.23(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 20.0±2°, c = 1% in DMF |
| BRN | 4609615 |
| Major Application | peptide synthesis |
| InChIKey | OQGAELAJEGGNKG-QHCPKHFHSA-N |
| SMILES | OC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 86060-84-6(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
