N,N-Dimethyl-1,4-phenylenediamine oxalate
- Product NameN,N-Dimethyl-1,4-phenylenediamine oxalate
- CAS62778-12-5
- MFC10H14N2O4
- MW226.23
- EINECS263-723-2
- MOL File62778-12-5.mol
Chemical Properties
| Melting point | 205 °C (dec.) (lit.) |
| Boiling point | 494.03°C (rough estimate) |
| Density | 1.2485 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | 2-8°C |
| form | Powder and Chunks |
| color | Gray or beige to brownish |
| InChI | 1S/2C8H12N2.C2H2O4/c2*1-10(2)8-5-3-7(9)4-6-8;3-1(4)2(5)6/h2*3-6H,9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MNUINXKPLPIOEF-UHFFFAOYSA-N |
| SMILES | OC(=O)C(O)=O.CN(C)c1ccc(N)cc1.CN(C)c2ccc(N)cc2 |
| CAS DataBase Reference | 62778-12-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Benzenediamine, N,N-dimethyl-, ethanedioate (2:1) (62778-12-5) |
Safety Information
| Hazard Codes | T+,T |
| Risk Statements | 20/21-28-36/37/38-43-23/24/25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | CZ1586550 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29215900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |