Triflupromazine hydrochloride
- Product NameTriflupromazine hydrochloride
- CAS1098-60-8
- MFC18H20ClF3N2S
- MW388.88
- EINECS214-149-6
- MOL File1098-60-8.mol
Chemical Properties
| Melting point | 174.0 to 179.0 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Soluble in water |
| solubility | DMF: 5mg/mL; DMSO: 3mg/mL; Ethanol: 5mg/mL; Ethanol:PBS (pH 7.2) (1:10): 0.09mg/mL |
| color | White to Light yellow |
| λmax | 305nm(H2O)(lit.) |
| Merck | 14,9685 |
| BRN | 3801519 |
| Stability | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H19F3N2S.ClH/c1-22(2)10-5-11-23-14-6-3-4-7-16(14)24-17-9-8-13(12-15(17)23)18(19,20)21;/h3-4,6-9,12H,5,10-11H2,1-2H3;1H |
| InChIKey | FTNWXGFYRHWUKG-UHFFFAOYSA-N |
| SMILES | Cl.CN(C)CCCN1c2ccccc2Sc3ccc(cc13)C(F)(F)F |
| CAS DataBase Reference | 1098-60-8 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SO8925000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2934302300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation |