TTNPB (Arotinoid Acid)
- Product NameTTNPB (Arotinoid Acid)
- CAS71441-28-6
- MFC24H28O2
- MW348.48
- EINECS
- MOL File71441-28-6.mol
Chemical Properties
| Melting point | 242 °C |
| Boiling point | 422.83°C (rough estimate) |
| Density | 1.0932 (rough estimate) |
| refractive index | 1.4480 (estimate) |
| storage temp. | -20°C |
| solubility | chloroform/methanol: soluble9.80 - 10.20 mg/mL, clear, colorless to light yellow |
| form | White solid |
| pka | 4.28±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C24H28O2/c1-16(14-17-6-8-18(9-7-17)22(25)26)19-10-11-20-21(15-19)24(4,5)13-12-23(20,2)3/h6-11,14-15H,12-13H2,1-5H3,(H,25,26)/b16-14+ |
| InChIKey | FOIVPCKZDPCJJY-JQIJEIRASA-N |
| SMILES | C(O)(=O)C1=CC=C(/C=C(/C2=CC=C3C(=C2)C(C)(C)CCC3(C)C)\C)C=C1 |
| CAS DataBase Reference | 71441-28-6 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 60-61-36/37/38 |
| Safety Statements | 53-26-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | DH6834900 |
| HS Code | 2916.39.7900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |