2-Bromo-6-chlorotoluene
- Product Name2-Bromo-6-chlorotoluene
- CAS62356-27-8
- MFC7H6BrCl
- MW205.48
- EINECS263-520-9
- MOL File62356-27-8.mol
Chemical Properties
| Boiling point | 100°C 25mm |
| Density | 1,56 g/cm3 |
| refractive index | 1.5780 |
| Flash point | 95°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.58 |
| color | Colorless to Light red to Green |
| InChI | InChI=1S/C7H6BrCl/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | DMARBQGIQKLIPM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(Cl)=C1C |
| CAS DataBase Reference | 62356-27-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50-22-36/38 |
| Safety Statements | 26-37-61 |
| HazardClass | IRRITANT |
| HS Code | 29038900 |