2-Bromo-4-chlorotoluene
- Product Name2-Bromo-4-chlorotoluene
- CAS27139-97-5
- MFC7H6BrCl
- MW205.48
- EINECS222-074-5
- MOL File27139-97-5.mol
Chemical Properties
| Melting point | 75-77°C |
| Boiling point | 112°C 20mm |
| Density | 1,54 g/cm3 |
| refractive index | 1.5720-1.5760 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.54 |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C7H6BrCl/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| InChIKey | CSUUXPHPCXHYGY-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 27139-97-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-22-36/38 |
| Safety Statements | 26-36/37/39-61-37 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
