N-Methylthiourea
- Product NameN-Methylthiourea
- CAS598-52-7
- MFC2H6N2S
- MW90.15
- EINECS209-936-6
- MOL File598-52-7.mol
Chemical Properties
| Melting point | 118-121 °C(lit.) |
| Boiling point | 141.1±23.0 °C(Predicted) |
| Density | 1.095 (estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| pka | 14.98±0.70(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| BRN | 506162 |
| InChI | InChI=1S/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| InChIKey | KQJQICVXLJTWQD-UHFFFAOYSA-N |
| SMILES | N(C)C(N)=S |
| CAS DataBase Reference | 598-52-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | YT9000000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Aquatic Chronic 2 |
