3-Fluoro-4-nitrotoluene
- Product Name3-Fluoro-4-nitrotoluene
- CAS446-34-4
- MFC7H6FNO2
- MW155.13
- EINECS207-166-5
- MOL File446-34-4.mol
Chemical Properties
| Melting point | 52-55 °C (lit.) |
| Boiling point | 97-98 °C/3 mmHg (lit.) |
| Density | 1,438 g/cm3 |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 2502584 |
| InChI | InChI=1S/C7H6FNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| InChIKey | WZMOWQCNPFDWPA-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(C)C=C1F |
| CAS DataBase Reference | 446-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Fluoro-4-nitrotoluene(446-34-4) |
| EPA Substance Registry System | 3-Fluoro-4-nitrotoluene (446-34-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-45-37-28A-24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
