5-Chloro-1-(4-piperidyl)-2-benzimidazolinone
- Product Name5-Chloro-1-(4-piperidyl)-2-benzimidazolinone
- CAS53786-28-0
- MFC12H14ClN3O
- MW251.71
- EINECS258-771-6
- MOL File53786-28-0.mol
Chemical Properties
| Melting point | 228-231 °C (lit.) |
| Density | 1.323±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 11.12±0.30(Predicted) |
| form | Powder to crystal |
| color | White to Off-White |
| Water Solubility | 549mg/L at 20℃ |
| InChI | InChI=1S/C12H14ClN3O/c13-8-1-2-11-10(7-8)15-12(17)16(11)9-3-5-14-6-4-9/h1-2,7,9,14H,3-6H2,(H,15,17) |
| InChIKey | DOAYWDKFDPSTSV-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C2CCNCC2)C2=CC=C(Cl)C=C2N1 |
| LogP | -0.6 at 20℃ |
| CAS DataBase Reference | 53786-28-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
