4,4'-Difluorobenzylideneaniline
- Product Name4,4'-Difluorobenzylideneaniline
- CAS39769-09-0
- MFC13H9F2N
- MW217.21
- EINECS
- MOL File39769-09-0.mol
Chemical Properties
| Melting point | 63-67 °C |
| Boiling point | 307.4±27.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.96±0.50(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
| InChIKey | FRNJXANITCYEMD-CXUHLZMHSA-N |
| SMILES | Fc1ccc(cc1)\C=N\c2ccc(F)cc2 |
| CAS DataBase Reference | 39769-09-0 |
Safety Information
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-37/38-41-51/53 |
| Safety Statements | 26-36/39-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |