2-Amino-thiophene-3-carboxylic acid amide
- Product Name2-Amino-thiophene-3-carboxylic acid amide
- CAS14080-51-4
- MFC5H6N2OS
- MW142.18
- EINECS
- MOL File14080-51-4.mol
Chemical Properties
| Melting point | 153-155°C |
| Boiling point | 321.8±22.0 °C(Predicted) |
| Density | 1.423±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 15.58±0.50(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C5H6N2OS/c6-4(8)3-1-2-9-5(3)7/h1-2H,7H2,(H2,6,8) |
| InChIKey | WHZIZZOTISTHCT-UHFFFAOYSA-N |
| SMILES | C1(N)SC=CC=1C(N)=O |
| CAS DataBase Reference | 14080-51-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Sens. 1 |