Naphthol as-Tr phosphate, monosodium salt
- Product NameNaphthol as-Tr phosphate, monosodium salt
- CAS4264-93-1
- MFC18H13ClNO5P.2Na
- MW435.71
- EINECS220-046-7
- MOL File4264-93-1.mol
Chemical Properties
| storage temp. | -20°C |
| solubility | H2O: 1 tablet/10 mL, clear, colorless |
| form | tablets |
| color | Off-white to light yellow |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| InChI | InChI=1S/C18H15ClNO5P.2Na/c1-11-8-14(19)6-7-16(11)20-18(21)15-9-12-4-2-3-5-13(12)10-17(15)25-26(22,23)24;;/h2-10H,1H3,(H,20,21)(H2,22,23,24);;/q;2*+1/p-2 |
| InChIKey | TYCHZTPSWMGRRI-UHFFFAOYSA-L |
| SMILES | C1(C(=O)NC2C=CC(Cl)=CC=2C)C=C2C(C=CC=C2)=CC=1OP([O-])([O-])=O.[Na+].[Na+] |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |