Naphthol as-Tr phosphate
- Product NameNaphthol as-Tr phosphate
- CAS2616-72-0
- MFC18H15ClNO5P
- MW391.74
- EINECS220-046-7
- MOL File2616-72-0.mol
Chemical Properties
| Density | 1.522±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 1.04±0.30(Predicted) |
| color | White to Light yellow to Dark green |
| BRN | 6666070 |
| InChI | InChI=1S/C18H15ClNO5P/c1-11-8-14(19)6-7-16(11)20-18(21)15-9-12-4-2-3-5-13(12)10-17(15)25-26(22,23)24/h2-10H,1H3,(H,20,21)(H2,22,23,24) |
| InChIKey | SHTFMUPUBYXPCD-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(OP(O)(O)=O)=C1C(NC1=CC=C(Cl)C=C1C)=O |
| CAS DataBase Reference | 2616-72-0 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2919.90.3000 |