| Boiling point |
71-72 °C/20 mmHg (lit.) |
| Density |
1.057 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.438(lit.) |
| Flash point |
96 °F |
| storage temp. |
Inert atmosphere,2-8°C |
| solubility |
Soluble in chloroform and methanol. |
| form |
Liquid |
| Specific Gravity |
1.057 |
| color |
Brown to black |
| BRN |
1098490 |
| Stability |
Volatile |
| InChI |
InChI=1S/C5H9ClO/c1-5(7)3-2-4-6/h2-4H2,1H3 |
| InChIKey |
XVRIEWDDMODMGA-UHFFFAOYSA-N |
| SMILES |
CC(=O)CCCCl |
| CAS DataBase Reference |
5891-21-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Pentanone, 5-chloro-(5891-21-4) |
| EPA Substance Registry System |
2-Pentanone, 5-chloro- (5891-21-4) |
