4-Vinylbiphenyl
- Product Name4-Vinylbiphenyl
- CAS2350-89-2
- MFC14H12
- MW180.25
- EINECS219-082-6
- MOL File2350-89-2.mol
Chemical Properties
| Melting point | 119-121 °C (lit.) |
| Boiling point | 136-138 °C(Press: 6 Torr) |
| Density | 0.997 |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 2039221 |
| InChI | InChI=1S/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
| InChIKey | HDBWAWNLGGMZRQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(C=C)C=C1 |
| CAS DataBase Reference | 2350-89-2(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38-53 |
| Safety Statements | 26-36/37/39-35 |
| WGK Germany | 3 |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
