(3S,11E)-3,4,5,6,9,10-Hexahydro-14,16-dihydroxy-3-(methyl-<sup>13</sup>C)-1H-2-benzoxacyclotetradecin-1,7(8H)-dione-<sup>13</sup>C<sub>17</sub>
- Product Name(3S,11E)-3,4,5,6,9,10-Hexahydro-14,16-dihydroxy-3-(methyl-<sup>13</sup>C)-1H-2-benzoxacyclotetradecin-1,7(8H)-dione-<sup>13</sup>C<sub>17</sub>
- CAS911392-43-3
- MFC18H22O5
- MW336.23
- EINECS200-835-2
- MOL File911392-43-3.mol
Chemical Properties
| Density | 1.169±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Flash point | 2℃ |
| storage temp. | -20°C |
| solubility | Acetonitrile: soluble |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChIKey | MBMQEIFVQACCCH-NMEASMPJSA-N |
| SMILES | [13CH3][13C@H]1[13CH2][13CH2][13CH2][13C](=O)[13CH2][13CH2][13CH2]\[13CH]=[13CH]\[13c]2[13cH][13c](O)[13cH][13c](O)[13c]2[13C](=O)O1 |
Safety Information
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |