| Melting point |
87-91 °C(lit.) |
| Boiling point |
160-162 °C7 mm Hg(lit.) |
| Density |
1.0431 (rough estimate) |
| refractive index |
1.5600 (estimate) |
| Flash point |
160-162°C/7mm |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| color |
White to Light yellow |
| BRN |
2047383 |
| InChI |
InChI=1S/C11H12O2/c1-13-11-7-3-4-8-9(11)5-2-6-10(8)12/h3-4,7H,2,5-6H2,1H3 |
| InChIKey |
BRCPWISABURVIH-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C(OC)=CC=C2)CCC1 |
| CAS DataBase Reference |
33892-75-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
5-Methoxy-1-tetralone(33892-75-0) |
