| Boiling point |
154-156 °C (lit.) |
| Density |
1.191 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.504(lit.) |
| Flash point |
115 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
1.191 |
| Water Solubility |
Insoluble |
| BRN |
1932657 |
| InChI |
InChI=1S/C7H6ClF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey |
FNPVYRJTBXHIPB-UHFFFAOYSA-N |
| SMILES |
C1(Cl)=CC=CC(F)=C1C |
| LogP |
3.39 |
| CAS DataBase Reference |
443-83-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzene, 1-chloro-3-fluoro-2-methyl-(443-83-4) |
| EPA Substance Registry System |
2-Chloro-6-fluorotoluene (443-83-4) |
