Borane-N,N-diethylaniline complex
- Product NameBorane-N,N-diethylaniline complex
- CAS13289-97-9
- MFC10H18BN
- MW163.07
- EINECS236-305-2
- MOL File13289-97-9.mol
Chemical Properties
| Melting point | −30-−27 °C(lit.) |
| Density | 0.917 g/mL at 25 °C(lit.) |
| refractive index | 1.5245-1.5265 |
| Flash point | 70 °F |
| storage temp. | Refrigerator |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | MAY DECOMPOSE |
| InChI | InChI=1S/C10H18BN/c1-3-12(11,4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2,11H3 |
| InChIKey | YPWBYWNNJVSNPQ-UHFFFAOYSA-N |
| SMILES | N(C1C=CC=CC=1)(CC)(CC)[B+3]([H-])([H-])[H-] |
| CAS DataBase Reference | 13289-97-9(CAS DataBase Reference) |
| EPA Substance Registry System | Boron, (N,N-diethylbenzenamine)trihydro-, (T-4)- (13289-97-9) |
Safety Information
| Risk Statements | 10-14-51/53-33-23/24/25-14/15 |
| Safety Statements | 16-33-36/37/39-43-9-61-45-28A-8 |
| RIDADR | UN 3398 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29299090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Flam. Liq. 2 Water-react 2 |
