Suc-Ala-Ala-Ala-PNA
- Product NameSuc-Ala-Ala-Ala-PNA
- CAS52299-14-6
- MFC19H25N5O8
- MW451.43
- EINECS257-823-5
- MOL File52299-14-6.mol
Chemical Properties
| Boiling point | 923.5±65.0 °C(Predicted) |
| Density | 1.370±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 3 mg/ml; DMSO: 5 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.3 mg/ml |
| pka | 4.69±0.10(Predicted) |
| form | White to off-white solid |
| color | white to off-white |
| BRN | 2928351 |
| Sequence | {Suc}-Ala-Ala-Ala-{pNA} |
| InChIKey | GVUGADOWXGKRAE-SRVKXCTJSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CCC(=O)O)C)C)C |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
