3-(5-Nitro-2-furyl)acrylic acid
- Product Name3-(5-Nitro-2-furyl)acrylic acid
- CAS6281-23-8
- MFC7H5NO5
- MW183.12
- EINECS228-488-2
- MOL File6281-23-8.mol
Chemical Properties
| Melting point | 238-240°C |
| Boiling point | 316.77°C (rough estimate) |
| Density | 1.6074 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| pka | 3.95±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C7H5NO5/c9-7(10)4-2-5-1-3-6(13-5)8(11)12/h1-4H,(H,9,10)/b4-2+ |
| InChIKey | LWOWNIPZHGWKNR-DUXPYHPUSA-N |
| SMILES | OC(=O)\C=C\c1ccc(o1)[N+]([O-])=O |
| CAS DataBase Reference | 6281-23-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | LT8566000 |
| HS Code | 2932.19.5100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
