[Bis(trifluoroacetoxy)iodo]pentafluorobenzene
- Product Name[Bis(trifluoroacetoxy)iodo]pentafluorobenzene
- CAS14353-88-9
- MFC10F11IO4
- MW519.99
- EINECS623-272-8
- MOL File14353-88-9.mol
Chemical Properties
| Melting point | 117-119 °C(lit.) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C10F11IO4/c11-1-2(12)4(14)6(5(15)3(1)13)22(25-7(23)9(16,17)18)26-8(24)10(19,20)21 |
| InChIKey | OQWAXRPJEPTTSZ-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([I](OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)c(F)c1F |
| CAS DataBase Reference | 14353-88-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2931900090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |