Naphthol as-mx phosphate
- Product NameNaphthol as-mx phosphate
- CAS1596-56-1
- MFC19H18NO5P
- MW371.32
- EINECS216-480-1
- MOL File1596-56-1.mol
Chemical Properties
| Melting point | 189-190°C |
| Density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | ethanol: 50mg/mL, clear to slightly hazy, colorless to faintly yellow (to Faint Brown) |
| form | powder |
| pka | 0.80±0.30(Predicted) |
| color | White to off-white |
| BRN | 6664873 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C19H18NO5P/c1-12-7-8-17(13(2)9-12)20-19(21)16-10-14-5-3-4-6-15(14)11-18(16)25-26(22,23)24/h3-11H,1-2H3,(H,20,21)(H2,22,23,24) |
| InChIKey | IOMLBTHPCVDRHM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3cc2OP(O)(O)=O)c(C)c1 |
| CAS DataBase Reference | 1596-56-1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
