2-(tert-Butyl)anthracene
- Product Name2-(tert-Butyl)anthracene
- CAS18801-00-8
- MFC18H18
- MW234.34
- EINECS242-588-3
- MOL File18801-00-8.mol
Chemical Properties
| Melting point | 146-148 °C(lit.) |
| Boiling point | 406.66°C (estimate) |
| Density | 1.0157 (estimate) |
| refractive index | 1.6855 (estimate) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C18H18/c1-18(2,3)17-9-8-15-10-13-6-4-5-7-14(13)11-16(15)12-17/h4-12H,1-3H3 |
| InChIKey | WBPXZSIKOVBSAS-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2)C=CC=C3)=CC=C1C(C)(C)C |
| CAS DataBase Reference | 18801-00-8 |
| EPA Substance Registry System | 2-tert-Butylanthracene (18801-00-8) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29029000 |
