| Melting point |
174-176 °C(lit.) |
| Boiling point |
229.26°C (rough estimate) |
| Density |
1.0877 (rough estimate) |
| refractive index |
1.5706 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
10.57±0.18(Predicted) |
| color |
White to Gray to Brown |
| InChI |
InChI=1S/C7H9NO/c1-5-4-6(8)2-3-7(5)9/h2-4,9H,8H2,1H3 |
| InChIKey |
HDGMAACKJSBLMW-UHFFFAOYSA-N |
| SMILES |
C1(O)=CC=C(N)C=C1C |
| CAS DataBase Reference |
2835-96-3(CAS DataBase Reference) |
| EPA Substance Registry System |
4-Amino-o-cresol (2835-96-3) |
