Dimethyl phenylphosphonite
- Product NameDimethyl phenylphosphonite
- CAS2946-61-4
- MFC8H11O2P
- MW170.15
- EINECS220-960-6
- MOL File2946-61-4.mol
Chemical Properties
| Boiling point | 77-79°C 7mm |
| Density | 1.072 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 1.072 |
| color | colorless |
| Water Solubility | Miscible with alcohol. Immiscible with water. |
| Sensitive | Air Sensitive |
| BRN | 1073018 |
| InChI | InChI=1S/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | LMZLQYYLELWCCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(P(OC)OC)C=C1 |
| CAS DataBase Reference | 2946-61-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931.90.6000 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |