N N-dimethyl-1 4-phenylenediamine sulfa&
- Product NameN N-dimethyl-1 4-phenylenediamine sulfa&
- CAS536-47-0
- MFC8H14N2O4S
- MW234.27
- EINECS208-636-2
- MOL File536-47-0.mol
Chemical Properties
| Melting point | 200-205 °C (dec.)(lit.) |
| Boiling point | 495 °C(lit.) |
| RTECS | ST1575000 |
| storage temp. | Refrigerator |
| solubility | water: soluble50mg/mL, clear to hazy, colorless to faintly yellow or pink |
| form | Powder |
| color | Beige-grayish to orange or brown |
| Water Solubility | Soluble in water. |
| Sensitive | Light Sensitive & Hygroscopic |
| BRN | 4612278 |
| InChI | 1S/C8H12N2.H2O4S/c1-10(2)8-5-3-7(9)4-6-8;1-5(2,3)4/h3-6H,9H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | GLUKPDKNLKRLHX-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.CN(C)c1ccc(N)cc1 |
| CAS DataBase Reference | 536-47-0 |
| EPA Substance Registry System | 1,4-Benzenediamine, N,N-dimethyl-, sulfate (1:1) (536-47-0) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-8 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29215900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |