| Melting point |
17 °C |
| Boiling point |
105-109 °C/0.1 mmHg (lit.) |
| Density |
1.12 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.511(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
13.03±0.20(Predicted) |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| optical activity |
[α]20/D 19°, c = 1 in acetone |
| Water Solubility |
Not miscible or difficult to mix in water. |
| BRN |
2048925 |
| InChI |
InChI=1S/C10H12O3/c1-8(11)10(12)13-7-9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3/t8-/m0/s1 |
| InChIKey |
ZYTLPUIDJRKAAM-QMMMGPOBSA-N |
| SMILES |
C(OCC1=CC=CC=C1)(=O)[C@@H](O)C |
| CAS DataBase Reference |
56777-24-3(CAS DataBase Reference) |
