L-(+)-Mandelic acid benzyl ester
- Product NameL-(+)-Mandelic acid benzyl ester
- CAS62173-99-3
- MFC15H14O3
- MW242.27
- EINECS241-580-7
- MOL File62173-99-3.mol
Chemical Properties
| Melting point | 107 °C |
| Boiling point | 386.8±27.0 °C(Predicted) |
| Density | 1.204±0.06 g/cm3(Predicted) |
| refractive index | 34 ° (C=1, CH3CN) |
| storage temp. | Storage temp. 2-8°C |
| pka | 12.15±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]25/D +55°, c = 1 in chloroform |
| InChI | 1S/C15H14O3/c16-14(13-9-5-2-6-10-13)15(17)18-11-12-7-3-1-4-8-12/h1-10,14,16H,11H2/t14-/m0/s1 |
| InChIKey | JFKWZVQEMSKSBU-AWEZNQCLSA-N |
| SMILES | O[C@H](C(=O)OCc1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 62173-99-3 |
