3-Dimethylaminopropionic acid hydrochloride
- Product Name3-Dimethylaminopropionic acid hydrochloride
- CAS14788-12-6
- MFC5H11NO2.ClH
- MW153.61
- EINECS
- MOL File14788-12-6.mol
Chemical Properties
| Melting point | 186.0 to 192.0 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.3-10.2 |
| color | White to Off-White |
| Water Solubility | almost transparency |
| Stability | Hygroscopic |
| InChI | 1S/C5H11NO2.ClH/c1-6(2)4-3-5(7)8;/h3-4H2,1-2H3,(H,7,8);1H |
| InChIKey | JTNKXYWGZCNBCH-UHFFFAOYSA-N |
| SMILES | [Cl-].N(CCC(=O)O)(C)C.[H+] |
| CAS DataBase Reference | 14788-12-6 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |