1,3,5-Trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- Product Name1,3,5-Trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- CAS844891-04-9
- MFC12H21BN2O2
- MW236.12
- EINECS
- MOL File844891-04-9.mol
Chemical Properties
| Melting point | 91-93°C |
| Boiling point | 335.7±42.0 °C(Predicted) |
| Density | 1.04±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.13±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H21BN2O2/c1-8-10(9(2)15(7)14-8)13-16-11(3,4)12(5,6)17-13/h1-7H3 |
| InChIKey | IZNGYNMIIVJWSO-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(C)c1B2OC(C)(C)C(C)(C)O2 |
| CAS DataBase Reference | 844891-04-9 |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36-22 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
