| Melting point |
98-100 °C (lit.) |
| Boiling point |
367.55°C (rough estimate) |
| Density |
1.0897 (rough estimate) |
| refractive index |
1.5200 (estimate) |
| solubility |
almost transparency in hot Methanol |
| form |
powder to crystal |
| color |
Light yellow to Yellow to Orange |
| InChI |
InChI=1S/C18H16O2/c1-18(2,3)11-8-9-14-15(10-11)17(20)13-7-5-4-6-12(13)16(14)19/h4-10H,1-3H3 |
| InChIKey |
YTPSFXZMJKMUJE-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1C(C)(C)C |
| LogP |
4.124 (est) |
| CAS DataBase Reference |
84-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Anthraquinone, 2-tert-butyl(84-47-9) |
| EPA Substance Registry System |
9,10-Anthracenedione, 2-(1,1-dimethylethyl)- (84-47-9) |
