Tetrakis(dimethylamino)ethylene
- Product NameTetrakis(dimethylamino)ethylene
- CAS996-70-3
- MFC10H24N4
- MW200.33
- EINECS213-638-1
- MOL File996-70-3.mol
Chemical Properties
| Melting point | >200 °C (decomp) |
| Boiling point | 98°C 25mm |
| Density | 0.861 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.48(lit.) |
| Flash point | 53°C |
| storage temp. | 0-10°C |
| pka | 6.47±0.70(Predicted) |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 1705900 |
| Stability | Stable. Incompatible with acid chlorides, acids, strong oxidizing agents, acid anhydrides, carbon dioxide, oxygen, chlorinated solvents. Reacts with oxygen in air to give a greenish-yellow emission. Flammable. |
| InChI | [1S/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3] || 1S/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3 |
| InChIKey | [CBXRMKZFYQISIV-UHFFFAOYSA-N] || CBXRMKZFYQISIV-UHFFFAOYSA-N |
| SMILES | [CN(C)\C(N(C)C)=C(\N(C)C)N(C)C] || CN(C)\C(N(C)C)=C(\N(C)C)N(C)C |
| CAS DataBase Reference | 996-70-3 |
| NIST Chemistry Reference | Tetrakis(dimethylamino)ethylene(996-70-3) |
| EPA Substance Registry System | Ethenetetramine, octamethyl- (996-70-3) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 16-27-36/37/39-45-26 |
| RIDADR | 3286 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2921.29.0055 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
