1-(2-Nitrophenyl)piperazine
- Product Name1-(2-Nitrophenyl)piperazine
- CAS59084-06-9
- MFC10H13N3O2
- MW207.23
- EINECS261-593-1
- MOL File59084-06-9.mol
Chemical Properties
| Boiling point | 142-144°C 1mm |
| Density | 1.222±0.06 g/cm3(Predicted) |
| refractive index | 1.6080 to 1.6120 |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 8.73±0.10(Predicted) |
| color | Orange to Red |
| InChI | 1S/C10H13N3O2/c14-13(15)10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 |
| InChIKey | YJRCDSXLKPERNV-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1c(cccc1)N2CCNCC2 |
| CAS DataBase Reference | 59084-06-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT-HARMFUL |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
