Ethyl perfluoro-n-amyl ketone
- Product NameEthyl perfluoro-n-amyl ketone
- CAS383177-55-7
- MFC8H5F11O
- MW326.11
- EINECS
- MOL File383177-55-7.mol
Chemical Properties
| Density | 1,53 g/cm3 |
| refractive index | 1.3050 to 1.3080 |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C12H13NO/c1-2-4-10-7-6-9-5-3-8-13-11(9)12(10)14/h3,5-8,14H,2,4H2,1H3 |
| InChIKey | VHTNJYGNFUMJTN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)CC |
| CAS DataBase Reference | 383177-55-7 |
| EPA Substance Registry System | Ethyl perfluoropentanyl ketone (383177-55-7) |
Safety Information
| RIDADR | UN 1224 3/PG III |
| WGK Germany | WGK 3 |
| HS Code | 2914.19.0000 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
