Copper(II) Dimethyldithiocarbamate
- Product NameCopper(II) Dimethyldithiocarbamate
- CAS137-29-1
- MFC6H12CuN2S4
- MW303.98
- EINECS205-287-8
- MOL File137-29-1.mol
Chemical Properties
| Melting point | 260°C |
| Boiling point | 415.51°C (estimate) |
| Density | 1,75 g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| form | powder to crystal |
| Specific Gravity | 1.75 |
| color | Orange to Amber to Dark red |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C3H7NS2.Cu/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | ZOUQIAGHKFLHIA-UHFFFAOYSA-L |
| SMILES | C(=S)(S[Cu]SC(=S)N(C)C)N(C)C |
| LogP | 4.55 |
| CAS DataBase Reference | 137-29-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(dimethyldithiocarbamato) copper complex(137-29-1) |
| EPA Substance Registry System | Copper dimethyldithiocarbamate (137-29-1) |
Safety Information
| RIDADR | 3077 |
| RTECS | FA0175000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2930200090 |