Benzoic acid, 3,4-dihydroxy-2-Methyl-, Methyl ester
- Product NameBenzoic acid, 3,4-dihydroxy-2-Methyl-, Methyl ester
- CAS740799-82-0
- MFC9H10O4
- MW182.17
- EINECS
- MOL File740799-82-0.mol
Chemical Properties
| Melting point | 158.0 to 163.0 °C |
| Boiling point | 344.7±37.0 °C(Predicted) |
| Density | 1.296±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.32±0.23(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C9H10O4/c1-5-6(9(12)13-2)3-4-7(10)8(5)11/h3-4,10-11H,1-2H3 |
| InChIKey | ONNFZKHTMFVKNY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(O)C(O)=C1C |
| CAS DataBase Reference | 740799-82-0 |