o-Toluenesulfonyl chloride
- Product Nameo-Toluenesulfonyl chloride
- CAS133-59-5
- MFC7H7ClO2S
- MW190.65
- EINECS205-113-0
- MOL File133-59-5.mol
Chemical Properties
| Melting point | 10°C |
| Boiling point | 254 °C(lit.) |
| Density | 1.320 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Store under inert gas |
| solubility | Acetonitrile (Slightly), Chloroform(Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | Soluble in hot alcohol, ether and benzene. Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 973180 |
| InChI | InChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3 |
| InChIKey | HDECRAPHCDXMIJ-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1C |
| CAS DataBase Reference | 133-59-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2-methyl- (133-59-5) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904100090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Hazardous Substances Data | 133-59-5(Hazardous Substances Data) |
