Tramadol hydrochloride
- Product NameTramadol hydrochloride
- CAS36282-47-0
- MFC16H25NO2.ClH
- MW299.84
- EINECS252-950-2
- MOL File36282-47-0.mol
Chemical Properties
| Melting point | 178-181 °C |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water and in methanol, very slightly soluble in acetone. |
| pka | 9.41 |
| form | solid |
| color | white to off-white |
| InChI | 1S/C16H25NO2.ClH/c1-17(2)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)19-3;/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3;1H/t14-,16+;/m1./s1 |
| InChIKey | PPKXEPBICJTCRU-XMZRARIVSA-N |
| SMILES | Cl.COc1cccc(c1)[C@@]2(O)CCCC[C@@H]2CN(C)C |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HS Code | 2922504500 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 STOT SE 3 |
| Toxicity | mouse,LD50,intravenous,61700ug/kg (61.7mg/kg),Arzneimittel-Forschung. Drug Research. Vol. 28, Pg. 114, 1978. |