Cyanuric acid (13C3)
- Product NameCyanuric acid (13C3)
- CAS201996-37-4
- MFC3H3N3O3
- MW132.1
- EINECS
- MOL File201996-37-4.mol
Chemical Properties
| Melting point | >300°C |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) |
| form | Solid |
| color | White to Pale Beige |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C3H3N3O3/c7-1-4-2(8)6-3(9)5-1/h(H3,4,5,6,7,8,9)/i1+1,2+1,3+1 |
| InChIKey | ZFSLODLOARCGLH-VMIGTVKRSA-N |
| SMILES | O=[13C]1N[13C](=O)N[13C](=O)N1 |
| CAS DataBase Reference | 201996-37-4 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |