![2-Chloro-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine Structure](/CAS/GIF/452972-11-1.gif)
2-Chloro-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine
- Product Name2-Chloro-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine
- CAS452972-11-1
- MFC11H15BClNO2
- MW239.51
- EINECS
- MOL File452972-11-1.mol
Chemical Properties
| Melting point | 34-38 °C |
| Boiling point | 335.1±27.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| pka | -0.27±0.10(Predicted) |
| color | White to yellow to light brown |
| InChI | 1S/C11H15BClNO2/c1-10(2)11(3,4)16-12(15-10)8-6-5-7-14-9(8)13/h5-7H,1-4H3 |
| InChIKey | XFZFMAUUZHBQSS-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2cccnc2Cl |
| CAS DataBase Reference | 452972-11-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
![2-Chloro-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine pictures](/ProductImageEN/2022-09/Small/77d576f2-1f4d-4574-901a-11a129911bda.png)
![2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE pictures](/ProductImageEN/2021-08/Small/5e995477-0f5b-4c4d-9a43-1123494abc2a.jpg)
![2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE pictures](https://img.chemicalbook.com/ProductImageEN/2020-1/Small/41c31098-330f-4f89-a4c8-db449616603e.jpg)