2-Methyl-3-nitrobenzyl chloride
- Product Name2-Methyl-3-nitrobenzyl chloride
- CAS60468-54-4
- MFC8H8ClNO2
- MW185.61
- EINECS262-249-3
- MOL File60468-54-4.mol
Chemical Properties
| Melting point | 43-46 °C (lit.) |
| Boiling point | 299.7±25.0 °C(Predicted) |
| Density | 1.2797 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C8H8ClNO2/c1-6-7(5-9)3-2-4-8(6)10(11)12/h2-4H,5H2,1H3 |
| InChIKey | XZNDXQGZPOZITR-UHFFFAOYSA-N |
| SMILES | C1(CCl)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 60468-54-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049095 |
