10-(2-Naphthyl)anthracene-9-boronic acid
- Product Name10-(2-Naphthyl)anthracene-9-boronic acid
- CAS597554-03-5
- MFC24H17BO2
- MW348.2
- EINECS808-164-2
- MOL File597554-03-5.mol
Chemical Properties
| Boiling point | 585.8±58.0 °C(Predicted) |
| Density | 1.30 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.63±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C24H17BO2/c26-25(27)24-21-11-5-3-9-19(21)23(20-10-4-6-12-22(20)24)18-14-13-16-7-1-2-8-17(16)15-18/h1-15,26-27H |
| InChIKey | YGVDBZMVEURVOW-UHFFFAOYSA-N |
| SMILES | B(C1C2=CC=CC=C2C(C2=CC=C3C(=C2)C=CC=C3)=C2C=1C=CC=C2)(O)O |
| CAS DataBase Reference | 597554-03-5 |