| Melting point |
81-83°C |
| Boiling point |
374.3±17.0 °C(Predicted) |
| Density |
1.135±0.06 g/cm3(Predicted) |
| vapor pressure |
0.001Pa at 25℃ |
| refractive index |
1.44 |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
slightly sol. in Methanol |
| form |
Powder |
| color |
White to Light yellow to Light orange |
| InChI |
InChI=1S/C13H11NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h2-6,9H,7H2,1H3 |
| InChIKey |
PYJMGUQHJINLLD-UHFFFAOYSA-N |
| SMILES |
C1(CC#N)=C2C(C=CC(OC)=C2)=CC=C1 |
| LogP |
2.79 at 26℃ and pH7 |
| Surface tension |
73.1mN/m at 12.33mg/L and 20℃ |
| CAS DataBase Reference |
138113-08-3 |
