3-Methyl-2(5H)-furanone
- Product Name3-Methyl-2(5H)-furanone
- CAS22122-36-7
- MFC5H6O2
- MW98.1
- EINECS
- MOL File22122-36-7.mol
Chemical Properties
| Melting point | 72-73 °C(Solv: ethyl ether (60-29-7)) |
| Boiling point | 97-99 °C20 mm Hg(lit.) |
| Density | 1.13 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 200 °F |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| BRN | 1642 |
| InChI | InChI=1S/C5H6O2/c1-4-2-3-7-5(4)6/h2H,3H2,1H3 |
| InChIKey | VGHBEMPMIVEGJP-UHFFFAOYSA-N |
| SMILES | O1CC=C(C)C1=O |
| CAS DataBase Reference | 22122-36-7 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2932.20.5050 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |