| Melting point |
168-172 °C(lit.) |
| Boiling point |
250.62°C (rough estimate) |
| Density |
1.316(20.0000℃) |
| refractive index |
1.5030 (estimate) |
| Flash point |
150℃ |
| storage temp. |
Store below +30°C. |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
powder |
| pka |
4.58±0.10(Predicted) |
| color |
slightly yellow |
| biological source |
synthetic |
| Water Solubility |
Soluble in alcohol and hot water. |
| Merck |
14,4062 |
| BRN |
1371483 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
cleaning products
cosmetics
flavors and fragrances
food and beverages
personal care |
| InChI |
1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| InChIKey |
KSEBMYQBYZTDHS-HWKANZROSA-N |
| SMILES |
O(C)c1c(ccc(c1)\C=C\C(=O)O)O |
| LogP |
1.641 (est) |
| CAS DataBase Reference |
537-98-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (e)-(537-98-4) |
