| Melting point |
0.1 °C |
| Boiling point |
797.89°C (rough estimate) |
| Density |
1.083 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.47(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Store below +30°C. |
| solubility |
Miscible with water, with anhydrous ethanol, with ethyl acetate and with methanol, practically insoluble in fatty oils and in liquid paraffin. |
| form |
viscous liquid |
| Specific Gravity |
1.090 (25/4℃) |
| color |
Light yellow to Yellow to Orange |
| Water Solubility |
100 g/L |
| Hydrophilic-Lipophilic Balance (HLB) |
15.6 |
| InChI |
InChI=1/C12H18O11/c13-1-3(15)9-8(19)10(11(20)22-9)23-12-7(18)6(17)5(16)4(2-14)21-12/h3-7,9,12-19H,1-2H2/t3-,4+,5+,6-,7+,9+,12?/s3 |
| InChIKey |
MLSJBGYKDYSOAE-YRYTZYTINA-N |
| SMILES |
OC1=C(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)O[C@@H]1[C@H](CO)O |&1:6,9,11,13,18,19,r| |
| EPA Substance Registry System |
Polysorbate 40 (9005-66-7) |
