| Melting point |
199-201 °C(lit.) |
| Boiling point |
294.32°C (rough estimate) |
| Density |
1.4334 (rough estimate) |
| refractive index |
1.5880 (estimate) |
| pka |
15.02±0.50(Predicted) |
| form |
powder to crystal |
| color |
White to Orange to Green |
| Water Solubility |
<0.01 g/100 mL at 18 ºC |
| BRN |
639263 |
| Stability |
Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI |
InChI=1S/C7H6N2O3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,(H2,8,10) |
| InChIKey |
ZESWUEBPRPGMTP-UHFFFAOYSA-N |
| SMILES |
C(N)(=O)C1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference |
619-80-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzamide, 4-nitro-(619-80-7) |
| EPA Substance Registry System |
p-Nitrobenzamide (619-80-7) |
