619-80-7
| Name | p-Nitrobenzamide |
| CAS | 619-80-7 |
| EINECS(EC#) | 210-613-7 |
| Molecular Formula | C7H6N2O3 |
| MDL Number | MFCD00007994 |
| Molecular Weight | 166.13 |
| MOL File | 619-80-7.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 199-201 °C(lit.) |
| Boiling point | 294.32°C (rough estimate) |
| density | 1.4334 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| form | powder to crystal |
| pka | 15.02±0.50(Predicted) |
| color | White to Orange to Green |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| Detection Methods | HPLC,NMR |
| BRN | 639263 |
| InChI | InChI=1S/C7H6N2O3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,(H2,8,10) |
| InChIKey | ZESWUEBPRPGMTP-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 619-80-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzamide, 4-nitro-(619-80-7) |
| EPA Substance Registry System | 619-80-7(EPA Substance) |
Safety Data
| Hazard Codes | T,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CV5601000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |